CAS 1030759-58-0 is the registry number for FO-4-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(furan-2-yl)-5-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,2,4-oxadiazole (CAS 1030759-58-0) is a chemical compound with the molecular formula C18H20N4O4S and a molecular weight of 388.4 g/mol. IUPAC name: 3-(furan-2-yl)-5-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,2,4-oxadiazole. InChIKey: BIMKUWYNAWNDAH-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O4S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 3-(furan-2-yl)-5-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,2,4-oxadiazole |
| InChIKey | BIMKUWYNAWNDAH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)CC3=NC(=NO3)C4=CC=CO4 |
Computed by PubChem (NCBI)