CAS 1030763-58-6 is the registry number for 3-Fluoro-4-(((5-methyl-1,3,4-oxadiazol-2-yl)thio)methyl)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile (CAS 1030763-58-6) is a chemical compound with the molecular formula C11H8FN3OS and a molecular weight of 249.27 g/mol. IUPAC name: 3-fluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile. InChIKey: COIWQYBSQLNJCZ-UHFFFAOYSA-N.
| Molecular formula | C11H8FN3OS |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 3-fluoro-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzonitrile |
| InChIKey | COIWQYBSQLNJCZ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)SCC2=C(C=C(C=C2)C#N)F |
Computed by PubChem (NCBI)