CAS 1030849-63-8 appears in our catalog under these names: Rizatriptan Trimethylammonium Chloride, Rizatriptan N,N,N-Trimethylethanammonium Chloride, Rizatriptan Impurity 10. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethyl]azanium (CAS 1030849-63-8) is a chemical compound with the molecular formula C16H22N5+ and a molecular weight of 284.38 g/mol. IUPAC name: trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethyl]azanium. InChIKey: DQJSUAORIKADOL-UHFFFAOYSA-N.
| Molecular formula | C16H22N5+ |
|---|---|
| Molecular weight | 284.38 g/mol |
| IUPAC name | trimethyl-[2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethyl]azanium |
| InChIKey | DQJSUAORIKADOL-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3 |
Computed by PubChem (NCBI)