CAS 1030937-27-9 appears in our catalog under these names: Losartan-d4, Losartan-d4, >95% (HPLC), Losartan D4, Losartan-d4, 99.93%. Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 5 mg, 1 mg.
[2-butyl-5-chloro-3-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol (CAS 1030937-27-9) is a chemical compound with the molecular formula C22H23ClN6O and a molecular weight of 426.9 g/mol. IUPAC name: [2-butyl-5-chloro-3-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol. InChIKey: PSIFNNKUMBGKDQ-IRYCTXJYSA-N.
| Molecular formula | C22H23ClN6O |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | [2-butyl-5-chloro-3-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol |
| InChIKey | PSIFNNKUMBGKDQ-IRYCTXJYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CN2C(=NC(=C2CO)Cl)CCCC)[2H])[2H])C3=CC=CC=C3C4=NNN=N4)[2H] |
Computed by PubChem (NCBI)