Products 1030939-70-8
CAS 1030939-70-8 appears in our catalog under these names: Pentanenitrile-d9, Pentanenitrile-d9, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g.
2,2,3,3,4,4,5,5,5-nonadeuteriopentanenitrile (CAS 1030939-70-8) is a chemical compound with the molecular formula C5H9N and a molecular weight of 92.19 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonadeuteriopentanenitrile. InChIKey: RFFFKMOABOFIDF-YNSOAAEFSA-N.
| Molecular formula | C5H9N |
|---|---|
| Molecular weight | 92.19 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonadeuteriopentanenitrile |
| InChIKey | RFFFKMOABOFIDF-YNSOAAEFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C#N |
Computed by PubChem (NCBI)