CAS 103112-36-3 is the registry number for Fenchlorazole. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid (CAS 103112-36-3) is a chemical compound with the molecular formula C10H4Cl5N3O2 and a molecular weight of 375.4 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid. InChIKey: HKELWJONQIFBPO-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl5N3O2 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid |
| InChIKey | HKELWJONQIFBPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)N2C(=NC(=N2)C(=O)O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)