Products 103112-36-3

CAS 103112-36-3 is the registry number for Fenchlorazole. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid (CAS 103112-36-3) is a chemical compound with the molecular formula C10H4Cl5N3O2 and a molecular weight of 375.4 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid. InChIKey: HKELWJONQIFBPO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H4Cl5N3O2
Molecular weight375.4 g/mol
IUPAC name1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid
InChIKeyHKELWJONQIFBPO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)N2C(=NC(=N2)C(=O)O)C(Cl)(Cl)Cl

Computed by PubChem (NCBI)