CAS 103119-91-1 is the registry number for Amikacin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R,4S,5S,6R)-6-(aminomethyl)oxane-2,3,4,5-tetrol (CAS 103119-91-1) is a chemical compound with the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-6-(aminomethyl)oxane-2,3,4,5-tetrol. InChIKey: FXVPOMKTIZKCTJ-DVKNGEFBSA-N.
| Molecular formula | C6H13NO5 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-6-(aminomethyl)oxane-2,3,4,5-tetrol |
| InChIKey | FXVPOMKTIZKCTJ-DVKNGEFBSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)N |
Computed by PubChem (NCBI)