CAS 103121-85-3 appears in our catalog under these names: Cefepime Impurity 11, Cefepime Impurity 5, Cefepime EP Impurity E Chloridion, 1-(((6R,7R)-7-Amino-2-carboxy-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-3-yl)methyl)-1-methylpyrrolidinium Chloride, >95% (HPLC), Cefepime Related Compound E. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 250mg, 25g, 10g, 50g, 100g, 1g, 5g.
(6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid chloride (CAS 103121-85-3) is a chemical compound with the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. IUPAC name: (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid chloride. InChIKey: UVKYDOZUOXJZSR-WYUVZMMLSA-N.
| Molecular formula | C13H20ClN3O3S |
|---|---|
| Molecular weight | 333.84 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid chloride |
| InChIKey | UVKYDOZUOXJZSR-WYUVZMMLSA-N |
| SMILES | C[N+]1(CCCC1)CC2=C(N3[C@@H]([C@@H](C3=O)N)SC2)C(=O)O.[Cl-] |
Computed by PubChem (NCBI)