CAS 1031337-15-1 is the registry number for Lithium (R)-4-(tert-butoxycarbonyl)morpholine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate (CAS 1031337-15-1) is a chemical compound with the molecular formula C10H16LiNO5 and a molecular weight of 237.2 g/mol. IUPAC name: lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate. InChIKey: USNLTWWHSGFIIE-OGFXRTJISA-M.
| Molecular formula | C10H16LiNO5 |
|---|---|
| Molecular weight | 237.2 g/mol |
| IUPAC name | lithium (2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylate |
| InChIKey | USNLTWWHSGFIIE-OGFXRTJISA-M |
| SMILES | [Li+].CC(C)(C)OC(=O)N1CCO[C@H](C1)C(=O)[O-] |
Computed by PubChem (NCBI)