CAS 103152-84-7 appears in our catalog under these names: Hydroxychloroquine EP Impurity B (Hydroxychloroquine O-Sulfate), Hydroxychloroquine Sulfate EP Impurity B, Hydroxychloroquine impurity 5, Hydroxychloroquine EP Impurity B Sodium Salt (Hydroxychloroquine O-Sulfate Sodium Salt). Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate (CAS 103152-84-7) is a chemical compound with the molecular formula C18H26ClN3O4S and a molecular weight of 415.9 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate. InChIKey: HDHZUDNKLODXFR-UHFFFAOYSA-N.
| Molecular formula | C18H26ClN3O4S |
|---|---|
| Molecular weight | 415.9 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethyl hydrogen sulfate |
| InChIKey | HDHZUDNKLODXFR-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCOS(=O)(=O)O |
Computed by PubChem (NCBI)