CAS 1031799-40-2 appears in our catalog under these names: NG–amino–L–Arginine (hydrochloride), NG-Amino-L-arginine (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 5 mg.
(2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]pentanoic acid;hydrochloride (CAS 1031799-40-2) is a chemical compound with the molecular formula C6H16ClN5O2 and a molecular weight of 225.68 g/mol. IUPAC name: (2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]pentanoic acid;hydrochloride. InChIKey: YGVMJVSXFJRHGQ-WCCKRBBISA-N.
| Molecular formula | C6H16ClN5O2 |
|---|---|
| Molecular weight | 225.68 g/mol |
| IUPAC name | (2S)-2-amino-5-[[amino(hydrazinyl)methylidene]amino]pentanoic acid;hydrochloride |
| InChIKey | YGVMJVSXFJRHGQ-WCCKRBBISA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)NN.Cl |
Computed by PubChem (NCBI)