Products 103183-65-9
CAS 103183-65-9 is the registry number for SDZ89-485. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-(4-chlorophenyl)-3-cyclopropyl-3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 103183-65-9) is a chemical compound with the molecular formula C16H20ClN3O and a molecular weight of 305.80 g/mol. IUPAC name: (2R)-2-(4-chlorophenyl)-3-cyclopropyl-3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: LHDGDQZODHEIPT-INIZCTEOSA-N.
| Molecular formula | C16H20ClN3O |
|---|---|
| Molecular weight | 305.80 g/mol |
| IUPAC name | (2R)-2-(4-chlorophenyl)-3-cyclopropyl-3-methyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | LHDGDQZODHEIPT-INIZCTEOSA-N |
| SMILES | CC(C)(C1CC1)[C@](CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)