CAS 1031927-02-2 appears in our catalog under these names: 4-(Imidazo[1,2-a]pyrazin-2-yl)-1,2,5-oxadiazol-3-amine, 95%, 4-(Imidazo[1,2-a]pyrazin-2-yl)-1,2,5-oxadiazol-3-amine 95%, 4-(Imidazo[1,2-a]pyrazin-2-yl)-1,2,5-oxadiazol-3-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-imidazo[1,2-a]pyrazin-2-yl-1,2,5-oxadiazol-3-amine (CAS 1031927-02-2) is a chemical compound with the molecular formula C8H6N6O and a molecular weight of 202.17 g/mol. IUPAC name: 4-imidazo[1,2-a]pyrazin-2-yl-1,2,5-oxadiazol-3-amine. InChIKey: YZWLTQHMDOCNGL-UHFFFAOYSA-N.
| Molecular formula | C8H6N6O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 4-imidazo[1,2-a]pyrazin-2-yl-1,2,5-oxadiazol-3-amine |
| InChIKey | YZWLTQHMDOCNGL-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C=N1)C3=NON=C3N |
Computed by PubChem (NCBI)