CAS 1031990-66-5 is the registry number for 7-Benzyl-2-(4-methylphenyl)-3H,4H,5H,6H,7H,8H-pyrido(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-benzyl-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (CAS 1031990-66-5) is a chemical compound with the molecular formula C21H21N3O and a molecular weight of 331.4 g/mol. IUPAC name: 7-benzyl-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one. InChIKey: IEPDZFAGLVPLML-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 7-benzyl-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| InChIKey | IEPDZFAGLVPLML-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(CCN(C3)CC4=CC=CC=C4)C(=O)N2 |
Computed by PubChem (NCBI)