Products 1031993-35-7
CAS 1031993-35-7 is the registry number for A1AR antagonist 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-cyclopentyl-5-methyl-3-[(4-methylbenzoyl)amino]-1H-indole-2-carboxamide (CAS 1031993-35-7) is a chemical compound with the molecular formula C23H25N3O2 and a molecular weight of 375.5 g/mol. IUPAC name: N-cyclopentyl-5-methyl-3-[(4-methylbenzoyl)amino]-1H-indole-2-carboxamide. InChIKey: OGRSNEFWEINPMM-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O2 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | N-cyclopentyl-5-methyl-3-[(4-methylbenzoyl)amino]-1H-indole-2-carboxamide |
| InChIKey | OGRSNEFWEINPMM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC2=C(NC3=C2C=C(C=C3)C)C(=O)NC4CCCC4 |
Computed by PubChem (NCBI)
Synonyms:
A1AR antagonist 4, orb1688500