CAS 103213-33-8 appears in our catalog under these names: D–Fructose–1,6–diphoshate calcium salt, D-Fructose-1,6-diphosphate monocalcium salt, D-Fructose-1,6-diphoshate calcium salt. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 5g, 10g, 50g, 100g, 1g.
Calcium [(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] phosphate (CAS 103213-33-8) is a chemical compound with the molecular formula C6H12CaO12P2 and a molecular weight of 378.18 g/mol. IUPAC name: calcium [(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] phosphate. InChIKey: QIUINQIXDJNFJN-BAOOBMCLSA-L.
| Molecular formula | C6H12CaO12P2 |
|---|---|
| Molecular weight | 378.18 g/mol |
| IUPAC name | calcium [(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] phosphate |
| InChIKey | QIUINQIXDJNFJN-BAOOBMCLSA-L |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)COP(=O)(O)O)O)O)O)OP(=O)([O-])[O-].[Ca+2] |
Computed by PubChem (NCBI)