CAS 103213-47-4 appears in our catalog under these names: Potassium ((2R,3S,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)methyl phosphate, 97%, D-Fructofuranose 6-(Dihydrogen phosphate) Dipotassium Salt, D–Fructose 6–phosphate dipotassium salt, D-Fructose 6-phosphate dipotassium salt, D-FRUCTOSE 6-PHOSPHATE DIPOTASSIUM. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 250mg, 100mg, 1g, 25mg, 500mg, 5g, 50 mg.
CAS 103213-47-4 identifies a chemical compound with the molecular formula C6H13KO9P and a molecular weight of 299.23 g/mol. InChIKey: QGPSDEVNXCUGNU-UHFFFAOYSA-N.
| Molecular formula | C6H13KO9P |
|---|---|
| Molecular weight | 299.23 g/mol |
| InChIKey | QGPSDEVNXCUGNU-UHFFFAOYSA-N |
| SMILES | C(C1C(C(C(O1)(CO)O)O)O)OP(=O)(O)O.[K] |
Computed by PubChem (NCBI)