CAS 1032229-36-9 is the registry number for 2-(Trifluoromethyl)pyrimidine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(trifluoromethyl)pyrimidine-5-carbonitrile (CAS 1032229-36-9) is a chemical compound with the molecular formula C6H2F3N3 and a molecular weight of 173.10 g/mol. IUPAC name: 2-(trifluoromethyl)pyrimidine-5-carbonitrile. InChIKey: IGNHQIRJJFLMDF-UHFFFAOYSA-N.
| Molecular formula | C6H2F3N3 |
|---|---|
| Molecular weight | 173.10 g/mol |
| IUPAC name | 2-(trifluoromethyl)pyrimidine-5-carbonitrile |
| InChIKey | IGNHQIRJJFLMDF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)