CAS 103229-89-6 appears in our catalog under these names: Perfluoro(4-methylpent-2-enoic acid), 95%, (Z)-2,3,4,5,5,5-Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid, 95%, (2E)-2,3,4,5,5,5-Hexafluoro-4-(Trifluoromethyl)-2-Pentenoic. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g, 10g.
(E)-2,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pent-2-enoic acid (CAS 103229-89-6) is a chemical compound with the molecular formula C6HF9O2 and a molecular weight of 276.06 g/mol. IUPAC name: (E)-2,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pent-2-enoic acid. InChIKey: TWDHAMRDYDLSPH-OWOJBTEDSA-N.
| Molecular formula | C6HF9O2 |
|---|---|
| Molecular weight | 276.06 g/mol |
| IUPAC name | (E)-2,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pent-2-enoic acid |
| InChIKey | TWDHAMRDYDLSPH-OWOJBTEDSA-N |
| SMILES | C(=C(/C(C(F)(F)F)(C(F)(F)F)F)\F)(\C(=O)O)/F |
Computed by PubChem (NCBI)