CAS 1032314-73-0 appears in our catalog under these names: Imatinib Impurity 5, N-(2-Methyl-5-aminophenyl)-4-(pyridin-3-yl)-6-methyl-2-pyrimidineamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
4-methyl-3-N-(4-methyl-6-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine (CAS 1032314-73-0) is a chemical compound with the molecular formula C17H17N5 and a molecular weight of 291.35 g/mol. IUPAC name: 4-methyl-3-N-(4-methyl-6-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine. InChIKey: PRKXDHJZVBTWGA-UHFFFAOYSA-N.
| Molecular formula | C17H17N5 |
|---|---|
| Molecular weight | 291.35 g/mol |
| IUPAC name | 4-methyl-3-N-(4-methyl-6-pyridin-3-ylpyrimidin-2-yl)benzene-1,3-diamine |
| InChIKey | PRKXDHJZVBTWGA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)NC2=NC(=CC(=N2)C3=CN=CC=C3)C |
Computed by PubChem (NCBI)