CAS 103247-89-8 appears in our catalog under these names: 4-(4-Bromophenyl)azetidin-2-one, 95%, 4-(4-Bromophenyl)azetidin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g, 50mg.
4-(4-bromophenyl)azetidin-2-one (CAS 103247-89-8) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 4-(4-bromophenyl)azetidin-2-one. InChIKey: YSIKXVRYGIZALB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 4-(4-bromophenyl)azetidin-2-one |
| InChIKey | YSIKXVRYGIZALB-UHFFFAOYSA-N |
| SMILES | C1C(NC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)