CAS 1032507-35-9 appears in our catalog under these names: 3-Bromo-2-methylbenzenesulfonamide, 95+%, 3-Bromo-2-methylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 50mg, 250mg, 1000mg, 500mg.
3-bromo-2-methylbenzenesulfonamide (CAS 1032507-35-9) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: 3-bromo-2-methylbenzenesulfonamide. InChIKey: OJPKVYUOZLYJSY-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 3-bromo-2-methylbenzenesulfonamide |
| InChIKey | OJPKVYUOZLYJSY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)S(=O)(=O)N |
Computed by PubChem (NCBI)