CAS 103251-39-4 appears in our catalog under these names: 3'-O-Amino-2'-deoxycytidine, 98%, 3'-O-NH2-2'-dC. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-amino-1-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 103251-39-4) is a chemical compound with the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. IUPAC name: 4-amino-1-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: OMLLESFFAQVGKX-SHYZEUOFSA-N.
| Molecular formula | C9H14N4O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 4-amino-1-[(2R,4S,5R)-4-aminooxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | OMLLESFFAQVGKX-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)CO)ON |
Computed by PubChem (NCBI)