Products 1032678-01-5
CAS 1032678-01-5 appears in our catalog under these names: Cyanine3 carboxylic acid chloride, Cyanine3 carboxylic acid (chloride), 99.77%, Cyanine3 carboxylic acid chloride, 97%, 2-(3-(1-(5-Carboxypentyl)-3,3-dimethylindolin-2-ylidene)prop-1-en-1-yl)-1,3,3-trimethyl-3H-indol-1-ium chloride, 97%, Cyanine 3 free acid. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 50mg, 5 mg, 10 mg, 50 mg.
6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid chloride (CAS 1032678-01-5) is a chemical compound with the molecular formula C30H37ClN2O2 and a molecular weight of 493.1 g/mol. IUPAC name: 6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid chloride. InChIKey: ITDHYDSGULGMLR-UHFFFAOYSA-N.
| Molecular formula | C30H37ClN2O2 |
|---|---|
| Molecular weight | 493.1 g/mol |
| IUPAC name | 6-[(2E)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]hexanoic acid chloride |
| InChIKey | ITDHYDSGULGMLR-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/3\C(C4=CC=CC=C4N3CCCCCC(=O)O)(C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)