CAS 1032815-08-9 is the registry number for 4-Chloro-5-(1,3-dioxolan-2-yl)-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(benzenesulfonyl)-4-chloro-5-(1,3-dioxolan-2-yl)pyrrolo[2,3-b]pyridine (CAS 1032815-08-9) is a chemical compound with the molecular formula C16H13ClN2O4S and a molecular weight of 364.8 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chloro-5-(1,3-dioxolan-2-yl)pyrrolo[2,3-b]pyridine. InChIKey: HJVQOLRMZIJZON-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O4S |
|---|---|
| Molecular weight | 364.8 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chloro-5-(1,3-dioxolan-2-yl)pyrrolo[2,3-b]pyridine |
| InChIKey | HJVQOLRMZIJZON-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CN=C3C(=C2Cl)C=CN3S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)