Products 1032947-73-1
CAS 1032947-73-1 is the registry number for Boc-L-Trp(2-CF3)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid (CAS 1032947-73-1) is a chemical compound with the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid. InChIKey: QQDUHAYTVWTECC-LBPRGKRZSA-N.
| Molecular formula | C17H19F3N2O4 |
|---|---|
| Molecular weight | 372.34 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)-1H-indol-3-yl]propanoic acid |
| InChIKey | QQDUHAYTVWTECC-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=C(NC2=CC=CC=C21)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)