CAS 103301-72-0 appears in our catalog under these names: GDP-D-glucose Disodium Salt, GDP-D-glucose sodium salt. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
CAS 103301-72-0 identifies a chemical compound with the molecular formula C16H25N5NaO16P2 and a molecular weight of 628.3 g/mol. InChIKey: XHHMWQPKNONDQU-UHFFFAOYSA-N.
| Molecular formula | C16H25N5NaO16P2 |
|---|---|
| Molecular weight | 628.3 g/mol |
| InChIKey | XHHMWQPKNONDQU-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OC4C(C(C(C(O4)CO)O)O)O)O)O)N=C(NC2=O)N.[Na] |
Computed by PubChem (NCBI)