CAS 10331-08-5 appears in our catalog under these names: 1H,1H,8H-Perfluoro-1-octanol, 95%, 2,2,3,3,4,4,5,5,6,6,7,7,8,8-Tetradecafluorooctan-1-ol, 97%, 1H,1H,8H-Perfluorooctanol, 1H,1H,8H-Perfluoro-1-octanol, 1H,1H,8H-Perfluoro-1-octanol, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Dr. Ehrenstorfer, TRC, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg, 500mg, 50mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol (CAS 10331-08-5) is a chemical compound with the molecular formula C8H4F14O and a molecular weight of 382.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol. InChIKey: ISIIJJQHILZBPB-UHFFFAOYSA-N.
| Molecular formula | C8H4F14O |
|---|---|
| Molecular weight | 382.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol |
| InChIKey | ISIIJJQHILZBPB-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)