CAS 103317-59-5 appears in our catalog under these names: Diclazuril Impurity 28, 2,6-Dichloro-Alpha-(4-chlorophenyl)-4-nitrobenzeneacetonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 2,5g, 50g.
2-(4-chlorophenyl)-2-(2,6-dichloro-4-nitrophenyl)acetonitrile (CAS 103317-59-5) is a chemical compound with the molecular formula C14H7Cl3N2O2 and a molecular weight of 341.6 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-(2,6-dichloro-4-nitrophenyl)acetonitrile. InChIKey: NATNDCQGSFJGBK-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl3N2O2 |
|---|---|
| Molecular weight | 341.6 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-(2,6-dichloro-4-nitrophenyl)acetonitrile |
| InChIKey | NATNDCQGSFJGBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)C2=C(C=C(C=C2Cl)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)