Products 103323-97-3

CAS 103323-97-3 is the registry number for 4-Ethoxy-2-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-ethoxy-2-methylbenzoic acid (CAS 103323-97-3) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 4-ethoxy-2-methylbenzoic acid. InChIKey: NPJNAEZUNKBQET-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight180.20 g/mol
IUPAC name4-ethoxy-2-methylbenzoic acid
InChIKeyNPJNAEZUNKBQET-UHFFFAOYSA-N
SMILESCCOC1=CC(=C(C=C1)C(=O)O)C

Computed by PubChem (NCBI)