CAS 10333-92-3 appears in our catalog under these names: Guanine sulfate, 95%, Guanine Sulfate, Guanine Sulfate Dihydrate, >98.0%(HPLC)(N), Guanine Sulfate, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g.
Bis(2-amino-1,7-dihydropurin-6-one);sulfuric acid (CAS 10333-92-3) is a chemical compound with the molecular formula C10H12N10O6S and a molecular weight of 400.33 g/mol. IUPAC name: bis(2-amino-1,7-dihydropurin-6-one);sulfuric acid. InChIKey: JXUOOUXZIHGPTG-UHFFFAOYSA-N.
| Molecular formula | C10H12N10O6S |
|---|---|
| Molecular weight | 400.33 g/mol |
| IUPAC name | bis(2-amino-1,7-dihydropurin-6-one);sulfuric acid |
| InChIKey | JXUOOUXZIHGPTG-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)NC(=N2)N.C1=NC2=C(N1)C(=O)NC(=N2)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)