CAS 103335-41-7 appears in our catalog under these names: Finasteride EP Impurity B, Finasteride EP Impurity B (Dutasteride Ester Impurity), Dutasteride Impurity 3, Finasteride Impurity 2(Finasteride EP Impurity B), 3-Oxo-4-aza-5a-androst-1-ene-17b-carboxylic Acid Methyl Ester, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 4x25mg, 1g.
Methyl (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate (CAS 103335-41-7) is a chemical compound with the molecular formula C20H29NO3 and a molecular weight of 331.4 g/mol. IUPAC name: methyl (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate. InChIKey: WMSQGMYJYBSBKA-ALHYADCGSA-N.
| Molecular formula | C20H29NO3 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | methyl (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylate |
| InChIKey | WMSQGMYJYBSBKA-ALHYADCGSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)OC)CC[C@@H]4[C@@]3(C=CC(=O)N4)C |
Computed by PubChem (NCBI)