CAS 1033439-46-1 is the registry number for (4-Fluoro-3-nitrophenyl)hydrazine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 2,5g, 250mg.
(4-fluoro-3-nitrophenyl)hydrazine;hydrochloride (CAS 1033439-46-1) is a chemical compound with the molecular formula C6H7ClFN3O2 and a molecular weight of 207.59 g/mol. IUPAC name: (4-fluoro-3-nitrophenyl)hydrazine;hydrochloride. InChIKey: CYFHFMNLBWYZCS-UHFFFAOYSA-N.
| Molecular formula | C6H7ClFN3O2 |
|---|---|
| Molecular weight | 207.59 g/mol |
| IUPAC name | (4-fluoro-3-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | CYFHFMNLBWYZCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)[N+](=O)[O-])F.Cl |
Computed by PubChem (NCBI)