CAS 1033744-31-8 is the registry number for 2,4-Dichloro-7-iodothieno(3,2-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dichloro-7-iodothieno[3,2-d]pyrimidine (CAS 1033744-31-8) is a chemical compound with the molecular formula C6HCl2IN2S and a molecular weight of 330.96 g/mol. IUPAC name: 2,4-dichloro-7-iodothieno[3,2-d]pyrimidine. InChIKey: ZXPZQDFKESECOV-UHFFFAOYSA-N.
| Molecular formula | C6HCl2IN2S |
|---|---|
| Molecular weight | 330.96 g/mol |
| IUPAC name | 2,4-dichloro-7-iodothieno[3,2-d]pyrimidine |
| InChIKey | ZXPZQDFKESECOV-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC(=N2)Cl)Cl)I |
Computed by PubChem (NCBI)