CAS 103404-72-4 is the registry number for H-Lys-Leu-OH acetate salt. Offered by: Biosynth. Available pack sizes: 1000mg, 2000mg, 5000mg.
Acetic acid;(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid (CAS 103404-72-4) is a chemical compound with the molecular formula C14H29N3O5 and a molecular weight of 319.40 g/mol. IUPAC name: acetic acid;(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid. InChIKey: VAGRBXWQTXIVKV-IYPAPVHQSA-N.
| Molecular formula | C14H29N3O5 |
|---|---|
| Molecular weight | 319.40 g/mol |
| IUPAC name | acetic acid;(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid |
| InChIKey | VAGRBXWQTXIVKV-IYPAPVHQSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N.CC(=O)O |
Computed by PubChem (NCBI)