Products 103404-72-4

CAS 103404-72-4 is the registry number for H-Lys-Leu-OH acetate salt. Offered by: Biosynth. Available pack sizes: 1000mg, 2000mg, 5000mg.

Structural formula: {0} (CAS {1})

Acetic acid;(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid (CAS 103404-72-4) is a chemical compound with the molecular formula C14H29N3O5 and a molecular weight of 319.40 g/mol. IUPAC name: acetic acid;(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid. InChIKey: VAGRBXWQTXIVKV-IYPAPVHQSA-N.

Identity
Molecular formulaC14H29N3O5
Molecular weight319.40 g/mol
IUPAC nameacetic acid;(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-methylpentanoic acid
InChIKeyVAGRBXWQTXIVKV-IYPAPVHQSA-N
SMILESCC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N.CC(=O)O

Computed by PubChem (NCBI)