CAS 1034138-15-2 is the registry number for 3–Cyclopentylthiophene–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-(3-cyclopentylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1034138-15-2) is a chemical compound with the molecular formula C15H23BO2S and a molecular weight of 278.2 g/mol. IUPAC name: 2-(3-cyclopentylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JXNHEHHCDIYVSK-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2S |
|---|---|
| Molecular weight | 278.2 g/mol |
| IUPAC name | 2-(3-cyclopentylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JXNHEHHCDIYVSK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)C3CCCC3 |
Computed by PubChem (NCBI)