CAS 10342-07-1 is the registry number for N-ω-Nitro-L-arginine benzyl ester. Offered by: Creative Peptides. Available pack sizes: on request.
Benzyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;4-methylbenzenesulfonic acid (CAS 10342-07-1) is a chemical compound with the molecular formula C20H27N5O7S and a molecular weight of 481.5 g/mol. IUPAC name: benzyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;4-methylbenzenesulfonic acid. InChIKey: DUIFZPVSNBDNLZ-MERQFXBCSA-N.
| Molecular formula | C20H27N5O7S |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | benzyl (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoate;4-methylbenzenesulfonic acid |
| InChIKey | DUIFZPVSNBDNLZ-MERQFXBCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)[C@H](CCCN=C(N)N[N+](=O)[O-])N |
Computed by PubChem (NCBI)