CAS 103427-15-2 is the registry number for 4-Nitrophenol-15N. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
4-[oxido(oxo)(15N)(15N)azaniumyl](15N)phenol (CAS 103427-15-2) is a chemical compound with the molecular formula C6H5NO3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-[oxido(oxo)(15N)(15N)azaniumyl](15N)phenol. InChIKey: BTJIUGUIPKRLHP-CDYZYAPPSA-N.
| Molecular formula | C6H5NO3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-[oxido(oxo)(15N)(15N)azaniumyl](15N)phenol |
| InChIKey | BTJIUGUIPKRLHP-CDYZYAPPSA-N |
| SMILES | C1=CC(=CC=C1[15N+](=O)[O-])O |
Computed by PubChem (NCBI)