CAS 103429-70-5 is the registry number for 1,1,-Di(phthalazine-yl)amine. Offered by: TRC. Available pack sizes: 25mg.
N-phthalazin-1-ylphthalazin-1-amine (CAS 103429-70-5) is a chemical compound with the molecular formula C16H11N5 and a molecular weight of 273.29 g/mol. IUPAC name: N-phthalazin-1-ylphthalazin-1-amine. InChIKey: RTPSCFGUJOWKJW-UHFFFAOYSA-N.
| Molecular formula | C16H11N5 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | N-phthalazin-1-ylphthalazin-1-amine |
| InChIKey | RTPSCFGUJOWKJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN=C2NC3=NN=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)