CAS 1034651-72-3 is the registry number for 4-((3-Ethynylphenyl)amino)quinazoline-6,7-diol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-ethynylanilino)quinazoline-6,7-diol;hydrochloride (CAS 1034651-72-3) is a chemical compound with the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. IUPAC name: 4-(3-ethynylanilino)quinazoline-6,7-diol;hydrochloride. InChIKey: RMCPBZLFTGFFTQ-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O2 |
|---|---|
| Molecular weight | 313.74 g/mol |
| IUPAC name | 4-(3-ethynylanilino)quinazoline-6,7-diol;hydrochloride |
| InChIKey | RMCPBZLFTGFFTQ-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC2=NC=NC3=CC(=C(C=C32)O)O.Cl |
Computed by PubChem (NCBI)