CAS 1034895-42-5 appears in our catalog under these names: 9–ING–41, 9-Ing-41, 95%, 9-ING-41/ 99.25% (existing batch purity), 9-ING-41 99%, 3-(5-Fuorobenzofuran-3-yl)-4-(5-methyl-5H-[1,3]dioxolo[4,5-f]indol-7-yl)-1H-pyrrole-2,5-dione, 98%, 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 250mg, 100mg, 1mg, 2mg, 10mg, 25mg, 50mg.
3-(5-fluoro-1-benzofuran-3-yl)-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione (CAS 1034895-42-5) is a chemical compound with the molecular formula C22H13FN2O5 and a molecular weight of 404.3 g/mol. IUPAC name: 3-(5-fluoro-1-benzofuran-3-yl)-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione. InChIKey: FARXPFGGGGLENU-UHFFFAOYSA-N.
| Molecular formula | C22H13FN2O5 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 3-(5-fluoro-1-benzofuran-3-yl)-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione |
| InChIKey | FARXPFGGGGLENU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC3=C(C=C21)OCO3)C4=C(C(=O)NC4=O)C5=COC6=C5C=C(C=C6)F |
Computed by PubChem (NCBI)