CAS 1035436-75-9 is the registry number for Pamidronic Acid-D2 (Major). Offered by: TRC. Available pack sizes: 25mg.
(3-amino-2,2,3,3-tetradeuterio-1-hydroxy-1-phosphonopropyl)phosphonic acid (CAS 1035436-75-9) is a chemical compound with the molecular formula C3H11NO7P2 and a molecular weight of 239.09 g/mol. IUPAC name: (3-amino-2,2,3,3-tetradeuterio-1-hydroxy-1-phosphonopropyl)phosphonic acid. InChIKey: WRUUGTRCQOWXEG-LNLMKGTHSA-N.
| Molecular formula | C3H11NO7P2 |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | (3-amino-2,2,3,3-tetradeuterio-1-hydroxy-1-phosphonopropyl)phosphonic acid |
| InChIKey | WRUUGTRCQOWXEG-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)C(O)(P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)