CAS 103567-80-2 is the registry number for 4,4'-(1,4-Phenylenebis(diphenylmethylene))dianiline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[4-[(4-aminophenyl)-diphenylmethyl]phenyl]-diphenylmethyl]aniline (CAS 103567-80-2) is a chemical compound with the molecular formula C44H36N2 and a molecular weight of 592.8 g/mol. IUPAC name: 4-[[4-[(4-aminophenyl)-diphenylmethyl]phenyl]-diphenylmethyl]aniline. InChIKey: NPHPBCOCNLDAFV-UHFFFAOYSA-N.
| Molecular formula | C44H36N2 |
|---|---|
| Molecular weight | 592.8 g/mol |
| IUPAC name | 4-[[4-[(4-aminophenyl)-diphenylmethyl]phenyl]-diphenylmethyl]aniline |
| InChIKey | NPHPBCOCNLDAFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=C(C=C6)N)C7=CC=C(C=C7)N |
Computed by PubChem (NCBI)