CAS 1035689-62-3 is the registry number for 3-Fluoro-3'-(trifluoromethoxy)-(1,1'-biphenyl)-4-amine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-fluoro-4-[3-(trifluoromethoxy)phenyl]aniline (CAS 1035689-62-3) is a chemical compound with the molecular formula C13H9F4NO and a molecular weight of 271.21 g/mol. IUPAC name: 2-fluoro-4-[3-(trifluoromethoxy)phenyl]aniline. InChIKey: SXGAIXHPMJFHEM-UHFFFAOYSA-N.
| Molecular formula | C13H9F4NO |
|---|---|
| Molecular weight | 271.21 g/mol |
| IUPAC name | 2-fluoro-4-[3-(trifluoromethoxy)phenyl]aniline |
| InChIKey | SXGAIXHPMJFHEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)