CAS 1035843-19-6 appears in our catalog under these names: 3-(3-Chloro-4-nitroisoxazol-5-yl)propanoic acid, 95%, 3-(3-Chloro-4-nitroisoxazol-5-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(3-chloro-4-nitro-1,2-oxazol-5-yl)propanoic acid (CAS 1035843-19-6) is a chemical compound with the molecular formula C6H5ClN2O5 and a molecular weight of 220.57 g/mol. IUPAC name: 3-(3-chloro-4-nitro-1,2-oxazol-5-yl)propanoic acid. InChIKey: XIUOTKIGDTVRCX-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O5 |
|---|---|
| Molecular weight | 220.57 g/mol |
| IUPAC name | 3-(3-chloro-4-nitro-1,2-oxazol-5-yl)propanoic acid |
| InChIKey | XIUOTKIGDTVRCX-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C1=C(C(=NO1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)