CAS 10359-09-8 appears in our catalog under these names: 2-(4-Chlorophenyl)-1,3-dithiane, 97%, 2–(4–Chlorophenyl)–1,3–dithiane, 2-(4-Chlorophenyl)-1,3-dithiane, 98.0%, 98.0%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(4-chlorophenyl)-1,3-dithiane (CAS 10359-09-8) is a chemical compound with the molecular formula C10H11ClS2 and a molecular weight of 230.8 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-dithiane. InChIKey: DMMIKGLVFJCJDY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClS2 |
|---|---|
| Molecular weight | 230.8 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-dithiane |
| InChIKey | DMMIKGLVFJCJDY-UHFFFAOYSA-N |
| SMILES | C1CSC(SC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)