CAS 103619-04-1 is the registry number for (-)-Invictolide . Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R,6S)-3,5-dimethyl-6-[(2R)-pentan-2-yl]oxan-2-one (CAS 103619-04-1) is a chemical compound with the molecular formula C12H22O2 and a molecular weight of 198.30 g/mol. IUPAC name: (3R,5R,6S)-3,5-dimethyl-6-[(2R)-pentan-2-yl]oxan-2-one. InChIKey: AZBHSLUQWMFDHU-DBIOUOCHSA-N.
| Molecular formula | C12H22O2 |
|---|---|
| Molecular weight | 198.30 g/mol |
| IUPAC name | (3R,5R,6S)-3,5-dimethyl-6-[(2R)-pentan-2-yl]oxan-2-one |
| InChIKey | AZBHSLUQWMFDHU-DBIOUOCHSA-N |
| SMILES | CCC[C@@H](C)[C@H]1[C@@H](C[C@H](C(=O)O1)C)C |
Computed by PubChem (NCBI)