CAS 10362-14-8 appears in our catalog under these names: 4-tert-Butylbenzene-1,3-diamine, 95%, 4-tert-Butylbenzene-1,3-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
4-tert-butylbenzene-1,3-diamine (CAS 10362-14-8) is a chemical compound with the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. IUPAC name: 4-tert-butylbenzene-1,3-diamine. InChIKey: JFQJDZQPICZGJF-UHFFFAOYSA-N.
| Molecular formula | C10H16N2 |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | 4-tert-butylbenzene-1,3-diamine |
| InChIKey | JFQJDZQPICZGJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)N)N |
Computed by PubChem (NCBI)