CAS 1036204-62-2 appears in our catalog under these names: Propargyl-peg6-ms, 95%, Propargyl-peg6-ms, 98%, Propargyl-PEG5-Ms/ min. 98%, Propargyl–PEG5–Ms, 3,6,9,12,15-Pentaoxaoctadec-17-yn-1-ol, 1-methanesulfonate. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 500mg, 1g, 25mg, 50mg, 100mg, 50 mg, 100 mg.
2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (CAS 1036204-62-2) is a chemical compound with the molecular formula C14H26O8S and a molecular weight of 354.42 g/mol. IUPAC name: 2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate. InChIKey: QIFZLEBUWOVSTB-UHFFFAOYSA-N.
| Molecular formula | C14H26O8S |
|---|---|
| Molecular weight | 354.42 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| InChIKey | QIFZLEBUWOVSTB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)