Products 103625-22-5
CAS 103625-22-5 is the registry number for AHN 086. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chloro-5-(4-chlorophenyl)-1-(2-isothiocyanatoethyl)-3H-1,4-benzodiazepin-2-one;hydrochloride (CAS 103625-22-5) is a chemical compound with the molecular formula C18H14Cl3N3OS and a molecular weight of 426.7 g/mol. IUPAC name: 7-chloro-5-(4-chlorophenyl)-1-(2-isothiocyanatoethyl)-3H-1,4-benzodiazepin-2-one;hydrochloride. InChIKey: ITUTZPYBBPRLKR-UHFFFAOYSA-N.
| Molecular formula | C18H14Cl3N3OS |
|---|---|
| Molecular weight | 426.7 g/mol |
| IUPAC name | 7-chloro-5-(4-chlorophenyl)-1-(2-isothiocyanatoethyl)-3H-1,4-benzodiazepin-2-one;hydrochloride |
| InChIKey | ITUTZPYBBPRLKR-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=C(C=C3)Cl)CCN=C=S.Cl |
Computed by PubChem (NCBI)
Synonyms:
Ahn-086, orb1703788